About [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride
[3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride (PubChem CID 126817079) has the molecular formula C4H9ClN4O
and a molecular weight of 164.60 g/mol. Its IUPAC name is [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride |
| PubChem CID | 126817079 |
| Molecular Formula | C4H9ClN4O |
| Molecular Weight | 164.60 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride |
| SMILES | Cl.NCc1n[nH]c(CO)n1 |
| InChI | InChI=1S/C4H8N4O.ClH/c5-1-3-6-4(2-9)8-7-3;/h9H,1-2,5H2,(H,6,7,8);1H |
| InChIKey | WDPKSJOWMHXLIE-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.60 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride?
The IUPAC name of [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride (CID 126817079) is [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride.
What is the SMILES notation for [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride?
The canonical SMILES for [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride is Cl.NCc1n[nH]c(CO)n1.
What is the InChIKey of [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride?
The InChIKey is WDPKSJOWMHXLIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O.ClH/c5-1-3-6-4(2-9)8-7-3;/h9H,1-2,5H2,(H,6,7,8);1H.
What are the key properties of [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride?
[3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride has a molecular weight of 164.60 g/mol, XLogP of -0.82, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)-1H-1,2,4-triazol-5-yl]methanol;hydrochloride is sourced from PubChem (CID 126817079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).