About 1-(1H-1,2,4-triazol-5-yl)ethanol
1-(1H-1,2,4-triazol-5-yl)ethanol (PubChem CID 21187528) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)ethanol |
| PubChem CID | 21187528 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)ethanol |
| SMILES | CC(O)c1ncn[nH]1 |
| InChI | InChI=1S/C4H7N3O/c1-3(8)4-5-2-6-7-4/h2-3,8H,1H3,(H,5,6,7) |
| InChIKey | WYZRLXYOIMXEBO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-1,2,4-triazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-1,2,4-triazol-5-yl)ethanol?
The IUPAC name of 1-(1H-1,2,4-triazol-5-yl)ethanol (CID 21187528) is 1-(1H-1,2,4-triazol-5-yl)ethanol.
What is the SMILES notation for 1-(1H-1,2,4-triazol-5-yl)ethanol?
The canonical SMILES for 1-(1H-1,2,4-triazol-5-yl)ethanol is CC(O)c1ncn[nH]1.
What is the InChIKey of 1-(1H-1,2,4-triazol-5-yl)ethanol?
The InChIKey is WYZRLXYOIMXEBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O/c1-3(8)4-5-2-6-7-4/h2-3,8H,1H3,(H,5,6,7).
What are the key properties of 1-(1H-1,2,4-triazol-5-yl)ethanol?
1-(1H-1,2,4-triazol-5-yl)ethanol has a molecular weight of 113.12 g/mol, XLogP of -0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-1,2,4-triazol-5-yl)ethanol is sourced from PubChem (CID 21187528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).