C4H7N3O — CID 21187528
1-(1H-1,2,4-triazol-5-yl)ethanol (PubChem CID 21187528) has the molecular formula C4H7N3O and a molecular weight of 113.12 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)ethanol.
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)ethanol |
|---|---|
| PubChem CID | 21187528 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)ethanol |
| SMILES | CC(O)c1ncn[nH]1 |
| InChI | InChI=1S/C4H7N3O/c1-3(8)4-5-2-6-7-4/h2-3,8H,1H3,(H,5,6,7) |
| InChIKey | WYZRLXYOIMXEBO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |