C13H19BrN2O2S — CID 126802467
N-[(3-bromo-4-methylphenyl)methyl]-2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethanamine (PubChem CID 126802467) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is N-[(3-bromo-4-methylphenyl)methyl]-2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethanamine.
| Compound Name | N-[(3-bromo-4-methylphenyl)methyl]-2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethanamine |
|---|---|
| PubChem CID | 126802467 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-[(3-bromo-4-methylphenyl)methyl]-2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethanamine |
| SMILES | Cc1ccc(CNCCN2CCCS2(=O)=O)cc1Br |
| InChI | InChI=1S/C13H19BrN2O2S/c1-11-3-4-12(9-13(11)14)10-15-5-7-16-6-2-8-19(16,17)18/h3-4,9,15H,2,5-8,10H2,1H3 |
| InChIKey | ZEKDOICKUYTLCA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|