C16H20BrNO5 — CID 126803185
ethyl 2-(3-bromo-4-methoxyphenyl)-2-[[(2S)-oxolane-2-carbonyl]amino]acetate (PubChem CID 126803185) has the molecular formula C16H20BrNO5 and a molecular weight of 386.24 g/mol. Its IUPAC name is ethyl 2-(3-bromo-4-methoxyphenyl)-2-[[(2S)-oxolane-2-carbonyl]amino]acetate.
| Compound Name | ethyl 2-(3-bromo-4-methoxyphenyl)-2-[[(2S)-oxolane-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 126803185 |
| Molecular Formula | C16H20BrNO5 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | ethyl 2-(3-bromo-4-methoxyphenyl)-2-[[(2S)-oxolane-2-carbonyl]amino]acetate |
| SMILES | CCOC(=O)C(NC(=O)[C@@H]1CCCO1)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C16H20BrNO5/c1-3-22-16(20)14(18-15(19)13-5-4-8-23-13)10-6-7-12(21-2)11(17)9-10/h6-7,9,13-14H,3-5,8H2,1-2H3,(H,18,19)/t13-,14?/m0/s1 |
| InChIKey | BNBWHTAWOVIXQI-LSLKUGRBSA-N |
| XLogP | 2.36 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |