C13H19N5O2S — CID 126804623
1-(pyrrolidine-1-carbonyl)-N-(thiadiazol-4-yl)piperidine-4-carboxamide (PubChem CID 126804623) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 1-(pyrrolidine-1-carbonyl)-N-(thiadiazol-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-(pyrrolidine-1-carbonyl)-N-(thiadiazol-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126804623 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(pyrrolidine-1-carbonyl)-N-(thiadiazol-4-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1csnn1)C1CCN(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C13H19N5O2S/c19-12(14-11-9-21-16-15-11)10-3-7-18(8-4-10)13(20)17-5-1-2-6-17/h9-10H,1-8H2,(H,14,19) |
| InChIKey | FVTVETURZILCPD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |