C16H30N2O4 — CID 126804783
N-[2-(4-hydroxyoxan-4-yl)ethyl]-2-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxamide (PubChem CID 126804783) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-[2-(4-hydroxyoxan-4-yl)ethyl]-2-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxamide.
| Compound Name | N-[2-(4-hydroxyoxan-4-yl)ethyl]-2-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 126804783 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | N-[2-(4-hydroxyoxan-4-yl)ethyl]-2-(3-hydroxypropyl)-2-methylpyrrolidine-1-carboxamide |
| SMILES | CC1(CCCO)CCCN1C(=O)NCCC1(O)CCOCC1 |
| InChI | InChI=1S/C16H30N2O4/c1-15(5-3-11-19)4-2-10-18(15)14(20)17-9-6-16(21)7-12-22-13-8-16/h19,21H,2-13H2,1H3,(H,17,20) |
| InChIKey | UWXGBTIQUSHWIT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |