C18H14F4N2O3 — CID 126805201
3-(2,2-difluoroethoxy)-4-[3-(2,6-difluorophenyl)prop-2-enoylamino]benzamide (PubChem CID 126805201) has the molecular formula C18H14F4N2O3 and a molecular weight of 382.31 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-4-[3-(2,6-difluorophenyl)prop-2-enoylamino]benzamide.
| Compound Name | 3-(2,2-difluoroethoxy)-4-[3-(2,6-difluorophenyl)prop-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 126805201 |
| Molecular Formula | C18H14F4N2O3 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-4-[3-(2,6-difluorophenyl)prop-2-enoylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)C=Cc2c(F)cccc2F)c(OCC(F)F)c1 |
| InChI | InChI=1S/C18H14F4N2O3/c19-12-2-1-3-13(20)11(12)5-7-17(25)24-14-6-4-10(18(23)26)8-15(14)27-9-16(21)22/h1-8,16H,9H2,(H2,23,26)(H,24,25) |
| InChIKey | VYDKNLCRSKYABH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|