C21H17F2N3O3 — CID 155966963
4-(2,2-difluoroethoxy)-3-[(4-pyridin-4-ylbenzoyl)amino]benzamide (PubChem CID 155966963) has the molecular formula C21H17F2N3O3 and a molecular weight of 397.38 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-3-[(4-pyridin-4-ylbenzoyl)amino]benzamide.
| Compound Name | 4-(2,2-difluoroethoxy)-3-[(4-pyridin-4-ylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 155966963 |
| Molecular Formula | C21H17F2N3O3 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-3-[(4-pyridin-4-ylbenzoyl)amino]benzamide |
| SMILES | NC(=O)c1ccc(OCC(F)F)c(NC(=O)c2ccc(-c3ccncc3)cc2)c1 |
| InChI | InChI=1S/C21H17F2N3O3/c22-19(23)12-29-18-6-5-16(20(24)27)11-17(18)26-21(28)15-3-1-13(2-4-15)14-7-9-25-10-8-14/h1-11,19H,12H2,(H2,24,27)(H,26,28) |
| InChIKey | NXTBBZNLRSKRFZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |