C16H18N4O2S — CID 126807386
3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]prop-2-enamide (PubChem CID 126807386) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]prop-2-enamide.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 126807386 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]prop-2-enamide |
| SMILES | CCn1c(CNC(=O)C=Cc2ccc3c(c2)CCO3)n[nH]c1=S |
| InChI | InChI=1S/C16H18N4O2S/c1-2-20-14(18-19-16(20)23)10-17-15(21)6-4-11-3-5-13-12(9-11)7-8-22-13/h3-6,9H,2,7-8,10H2,1H3,(H,17,21)(H,19,23) |
| InChIKey | PNLJWPKIUPXERV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|