C18H19N3O3 — CID 126811482
N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]hex-5-ynamide (PubChem CID 126811482) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]hex-5-ynamide.
| Compound Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]hex-5-ynamide |
|---|---|
| PubChem CID | 126811482 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-1H-pyrazol-3-yl]hex-5-ynamide |
| SMILES | C#CCCCC(=O)Nc1n[nH]c(C)c1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H19N3O3/c1-3-4-5-6-16(22)19-18-17(12(2)20-21-18)13-7-8-14-15(11-13)24-10-9-23-14/h1,7-8,11H,4-6,9-10H2,2H3,(H2,19,20,21,22) |
| InChIKey | CGXMTGLYILGGQA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|