C17H22N4O — CID 126813929
N-benzyl-N-(2-methylprop-2-enyl)-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 126813929) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is N-benzyl-N-(2-methylprop-2-enyl)-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-benzyl-N-(2-methylprop-2-enyl)-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 126813929 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N-benzyl-N-(2-methylprop-2-enyl)-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | C=C(C)CN(Cc1ccccc1)C(=O)CCCn1cncn1 |
| InChI | InChI=1S/C17H22N4O/c1-15(2)11-20(12-16-7-4-3-5-8-16)17(22)9-6-10-21-14-18-13-19-21/h3-5,7-8,13-14H,1,6,9-12H2,2H3 |
| InChIKey | ULWQISPCAYRRTC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|