C13H16N2O5S2 — CID 126815883
(4-cyanophenyl) (1-methylsulfonylpyrrolidin-3-yl)methanesulfonate (PubChem CID 126815883) has the molecular formula C13H16N2O5S2 and a molecular weight of 344.41 g/mol. Its IUPAC name is (4-cyanophenyl) (1-methylsulfonylpyrrolidin-3-yl)methanesulfonate.
| Compound Name | (4-cyanophenyl) (1-methylsulfonylpyrrolidin-3-yl)methanesulfonate |
|---|---|
| PubChem CID | 126815883 |
| Molecular Formula | C13H16N2O5S2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | (4-cyanophenyl) (1-methylsulfonylpyrrolidin-3-yl)methanesulfonate |
| SMILES | CS(=O)(=O)N1CCC(CS(=O)(=O)Oc2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C13H16N2O5S2/c1-21(16,17)15-7-6-12(9-15)10-22(18,19)20-13-4-2-11(8-14)3-5-13/h2-5,12H,6-7,9-10H2,1H3 |
| InChIKey | BUGKBXNLSFASND-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|