About 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide
4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide (PubChem CID 126816609) has the molecular formula C14H13FN4O2
and a molecular weight of 288.28 g/mol. Its IUPAC name is 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide |
| PubChem CID | 126816609 |
| Molecular Formula | C14H13FN4O2 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide |
| SMILES | Nc1ncncc1C(=O)NC1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C14H13FN4O2/c15-8-1-2-12-9(5-8)11(3-4-21-12)19-14(20)10-6-17-7-18-13(10)16/h1-2,5-7,11H,3-4H2,(H,19,20)(H2,16,17,18) |
| InChIKey | NFLXJWKYFUTWEW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide?
The IUPAC name of 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide (CID 126816609) is 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide.
What is the SMILES notation for 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide?
The canonical SMILES for 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide is Nc1ncncc1C(=O)NC1CCOc2ccc(F)cc21.
What is the InChIKey of 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide?
The InChIKey is NFLXJWKYFUTWEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN4O2/c15-8-1-2-12-9(5-8)11(3-4-21-12)19-14(20)10-6-17-7-18-13(10)16/h1-2,5-7,11H,3-4H2,(H,19,20)(H2,16,17,18).
What are the key properties of 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide?
4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide has a molecular weight of 288.28 g/mol, XLogP of 1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(6-fluoro-3,4-dihydro-2H-chromen-4-yl)pyrimidine-5-carboxamide is sourced from PubChem (CID 126816609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).