C12H24N4O4S — CID 126816919
1-[2-(dimethylsulfamoylamino)acetyl]-2-(2-methylpropyl)-3-oxopiperazine (PubChem CID 126816919) has the molecular formula C12H24N4O4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-[2-(dimethylsulfamoylamino)acetyl]-2-(2-methylpropyl)-3-oxopiperazine.
| Compound Name | 1-[2-(dimethylsulfamoylamino)acetyl]-2-(2-methylpropyl)-3-oxopiperazine |
|---|---|
| PubChem CID | 126816919 |
| Molecular Formula | C12H24N4O4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[2-(dimethylsulfamoylamino)acetyl]-2-(2-methylpropyl)-3-oxopiperazine |
| SMILES | CC(C)CC1C(=O)NCCN1C(=O)CNS(=O)(=O)N(C)C |
| InChI | InChI=1S/C12H24N4O4S/c1-9(2)7-10-12(18)13-5-6-16(10)11(17)8-14-21(19,20)15(3)4/h9-10,14H,5-8H2,1-4H3,(H,13,18) |
| InChIKey | NGODSRWFAOPOGH-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |