C16H29N3O4 — CID 54813767
2-methylpropyl 2-[1-[2-(tert-butylamino)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54813767) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-methylpropyl 2-[1-[2-(tert-butylamino)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-methylpropyl 2-[1-[2-(tert-butylamino)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54813767 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 2-methylpropyl 2-[1-[2-(tert-butylamino)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CC(C)COC(=O)CC1C(=O)NCCN1C(=O)CNC(C)(C)C |
| InChI | InChI=1S/C16H29N3O4/c1-11(2)10-23-14(21)8-12-15(22)17-6-7-19(12)13(20)9-18-16(3,4)5/h11-12,18H,6-10H2,1-5H3,(H,17,22) |
| InChIKey | CQPPLDVXAGNJKF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |