C17H20N4O5S2 — CID 126817552
N-[5-[[4-(dimethylsulfamoyl)phenyl]sulfonylamino]-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 126817552) has the molecular formula C17H20N4O5S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[5-[[4-(dimethylsulfamoyl)phenyl]sulfonylamino]-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[5-[[4-(dimethylsulfamoyl)phenyl]sulfonylamino]-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 126817552 |
| Molecular Formula | C17H20N4O5S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N-[5-[[4-(dimethylsulfamoyl)phenyl]sulfonylamino]-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(S(=O)(=O)Nc2ccc(NC(=O)C3CC3)nc2)cc1 |
| InChI | InChI=1S/C17H20N4O5S2/c1-21(2)28(25,26)15-8-6-14(7-9-15)27(23,24)20-13-5-10-16(18-11-13)19-17(22)12-3-4-12/h5-12,20H,3-4H2,1-2H3,(H,18,19,22) |
| InChIKey | UZZCYTXQFNXHOH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |