C19H28N2O4 — CID 126819158
(3S,4S)-N-(2-hydroxy-3-morpholin-4-ylpropyl)-4-phenyloxane-3-carboxamide (PubChem CID 126819158) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is (3S,4S)-N-(2-hydroxy-3-morpholin-4-ylpropyl)-4-phenyloxane-3-carboxamide.
| Compound Name | (3S,4S)-N-(2-hydroxy-3-morpholin-4-ylpropyl)-4-phenyloxane-3-carboxamide |
|---|---|
| PubChem CID | 126819158 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (3S,4S)-N-(2-hydroxy-3-morpholin-4-ylpropyl)-4-phenyloxane-3-carboxamide |
| SMILES | O=C(NCC(O)CN1CCOCC1)[C@@H]1COCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H28N2O4/c22-16(13-21-7-10-24-11-8-21)12-20-19(23)18-14-25-9-6-17(18)15-4-2-1-3-5-15/h1-5,16-18,22H,6-14H2,(H,20,23)/t16?,17-,18-/m1/s1 |
| InChIKey | OGNLGUPYYFJIIV-UKKPGEIXSA-N |
| XLogP | 0.62 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |