C13H19FN4O4 — CID 126823745
1-[(2-fluoro-3-nitro-4-pyridinyl)-methylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 126823745) has the molecular formula C13H19FN4O4 and a molecular weight of 314.32 g/mol. Its IUPAC name is 1-[(2-fluoro-3-nitro-4-pyridinyl)-methylamino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[(2-fluoro-3-nitro-4-pyridinyl)-methylamino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 126823745 |
| Molecular Formula | C13H19FN4O4 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-[(2-fluoro-3-nitro-4-pyridinyl)-methylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | CN(CC(O)CN1CCOCC1)c1ccnc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19FN4O4/c1-16(8-10(19)9-17-4-6-22-7-5-17)11-2-3-15-13(14)12(11)18(20)21/h2-3,10,19H,4-9H2,1H3 |
| InChIKey | AWGHOZXURRYGHY-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|