C15H17N3O3 — CID 126824030
3-cyclopropyl-N-[2-(4-methylphenoxy)ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 126824030) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-cyclopropyl-N-[2-(4-methylphenoxy)ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-cyclopropyl-N-[2-(4-methylphenoxy)ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 126824030 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-cyclopropyl-N-[2-(4-methylphenoxy)ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1ccc(OCCNC(=O)c2nc(C3CC3)no2)cc1 |
| InChI | InChI=1S/C15H17N3O3/c1-10-2-6-12(7-3-10)20-9-8-16-14(19)15-17-13(18-21-15)11-4-5-11/h2-3,6-7,11H,4-5,8-9H2,1H3,(H,16,19) |
| InChIKey | LBZPFCQEGMRHSK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|