C10H10ClF3N2O4S — CID 126824127
N-[5-chloro-2-(trifluoromethoxy)phenyl]-2-(methylsulfamoyl)acetamide (PubChem CID 126824127) has the molecular formula C10H10ClF3N2O4S and a molecular weight of 346.71 g/mol. Its IUPAC name is N-[5-chloro-2-(trifluoromethoxy)phenyl]-2-(methylsulfamoyl)acetamide.
| Compound Name | N-[5-chloro-2-(trifluoromethoxy)phenyl]-2-(methylsulfamoyl)acetamide |
|---|---|
| PubChem CID | 126824127 |
| Molecular Formula | C10H10ClF3N2O4S |
| Molecular Weight | 346.71 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | N-[5-chloro-2-(trifluoromethoxy)phenyl]-2-(methylsulfamoyl)acetamide |
| SMILES | CNS(=O)(=O)CC(=O)Nc1cc(Cl)ccc1OC(F)(F)F |
| InChI | InChI=1S/C10H10ClF3N2O4S/c1-15-21(18,19)5-9(17)16-7-4-6(11)2-3-8(7)20-10(12,13)14/h2-4,15H,5H2,1H3,(H,16,17) |
| InChIKey | XNSOQNMSHKXANO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |