C17H20FN3O2 — CID 126824169
1-(5-fluoro-2-pyridinyl)-3-(3-hydroxy-2,2-dimethyl-1-phenylpropyl)urea (PubChem CID 126824169) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-3-(3-hydroxy-2,2-dimethyl-1-phenylpropyl)urea.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-3-(3-hydroxy-2,2-dimethyl-1-phenylpropyl)urea |
|---|---|
| PubChem CID | 126824169 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-3-(3-hydroxy-2,2-dimethyl-1-phenylpropyl)urea |
| SMILES | CC(C)(CO)C(NC(=O)Nc1ccc(F)cn1)c1ccccc1 |
| InChI | InChI=1S/C17H20FN3O2/c1-17(2,11-22)15(12-6-4-3-5-7-12)21-16(23)20-14-9-8-13(18)10-19-14/h3-10,15,22H,11H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | KLUHNPZWKUGPNR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |