C16H18N4O3 — CID 126825268
[(3R,4R)-3-hydroxy-4-(triazol-1-yl)pyrrolidin-1-yl]-(2-prop-2-enoxyphenyl)methanone (PubChem CID 126825268) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is [(3R,4R)-3-hydroxy-4-(triazol-1-yl)pyrrolidin-1-yl]-(2-prop-2-enoxyphenyl)methanone.
| Compound Name | [(3R,4R)-3-hydroxy-4-(triazol-1-yl)pyrrolidin-1-yl]-(2-prop-2-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 126825268 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(3R,4R)-3-hydroxy-4-(triazol-1-yl)pyrrolidin-1-yl]-(2-prop-2-enoxyphenyl)methanone |
| SMILES | C=CCOc1ccccc1C(=O)N1C[C@@H](O)[C@H](n2ccnn2)C1 |
| InChI | InChI=1S/C16H18N4O3/c1-2-9-23-15-6-4-3-5-12(15)16(22)19-10-13(14(21)11-19)20-8-7-17-18-20/h2-8,13-14,21H,1,9-11H2/t13-,14-/m1/s1 |
| InChIKey | BOCPTVGKPHVYKV-ZIAGYGMSSA-N |
| XLogP | 0.90 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|