C14H13ClF3N3O — CID 126827796
2-chloro-4-methyl-N-[2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl]benzamide (PubChem CID 126827796) has the molecular formula C14H13ClF3N3O and a molecular weight of 331.73 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl]benzamide.
| Compound Name | 2-chloro-4-methyl-N-[2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126827796 |
| Molecular Formula | C14H13ClF3N3O |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-chloro-4-methyl-N-[2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCc2cn[nH]c2C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H13ClF3N3O/c1-8-2-3-10(11(15)6-8)13(22)19-5-4-9-7-20-21-12(9)14(16,17)18/h2-3,6-7H,4-5H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | WRRWXSKNIIKEBK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |