C13H18F3N3O2 — CID 126829249
N-(4-hydroxybutyl)-2-methyl-6-(2,2,2-trifluoroethylamino)pyridine-4-carboxamide (PubChem CID 126829249) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-2-methyl-6-(2,2,2-trifluoroethylamino)pyridine-4-carboxamide.
| Compound Name | N-(4-hydroxybutyl)-2-methyl-6-(2,2,2-trifluoroethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 126829249 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-(4-hydroxybutyl)-2-methyl-6-(2,2,2-trifluoroethylamino)pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCCO)cc(NCC(F)(F)F)n1 |
| InChI | InChI=1S/C13H18F3N3O2/c1-9-6-10(12(21)17-4-2-3-5-20)7-11(19-9)18-8-13(14,15)16/h6-7,20H,2-5,8H2,1H3,(H,17,21)(H,18,19) |
| InChIKey | GXPQUSSJYBEYNP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|