C13H18N4OS — CID 126829407
2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile (PubChem CID 126829407) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 126829407 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile |
| SMILES | Cc1cc(C(=O)N2CC(C)N(CC#N)C(C)C2)ns1 |
| InChI | InChI=1S/C13H18N4OS/c1-9-7-16(8-10(2)17(9)5-4-14)13(18)12-6-11(3)19-15-12/h6,9-10H,5,7-8H2,1-3H3 |
| InChIKey | GYDQHKWQJQNSFD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|