About 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile
2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile (PubChem CID 126829407) has the molecular formula C13H18N4OS
and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile |
| PubChem CID | 126829407 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile |
| SMILES | Cc1cc(C(=O)N2CC(C)N(CC#N)C(C)C2)ns1 |
| InChI | InChI=1S/C13H18N4OS/c1-9-7-16(8-10(2)17(9)5-4-14)13(18)12-6-11(3)19-15-12/h6,9-10H,5,7-8H2,1-3H3 |
| InChIKey | GYDQHKWQJQNSFD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile?
The IUPAC name of 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile (CID 126829407) is 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile.
What is the SMILES notation for 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile?
The canonical SMILES for 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile is Cc1cc(C(=O)N2CC(C)N(CC#N)C(C)C2)ns1.
What is the InChIKey of 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile?
The InChIKey is GYDQHKWQJQNSFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4OS/c1-9-7-16(8-10(2)17(9)5-4-14)13(18)12-6-11(3)19-15-12/h6,9-10H,5,7-8H2,1-3H3.
What are the key properties of 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile?
2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile has a molecular weight of 278.38 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-dimethyl-4-(5-methyl-1,2-thiazole-3-carbonyl)piperazin-1-yl]acetonitrile is sourced from PubChem (CID 126829407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).