C18H30N4O — CID 126829632
N-[1-(3,4-dimethylcyclohex-3-en-1-yl)ethyl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 126829632) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is N-[1-(3,4-dimethylcyclohex-3-en-1-yl)ethyl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | N-[1-(3,4-dimethylcyclohex-3-en-1-yl)ethyl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 126829632 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | N-[1-(3,4-dimethylcyclohex-3-en-1-yl)ethyl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | COCc1nc2n(n1)CC(NC(C)C1CCC(C)=C(C)C1)CC2 |
| InChI | InChI=1S/C18H30N4O/c1-12-5-6-15(9-13(12)2)14(3)19-16-7-8-18-20-17(11-23-4)21-22(18)10-16/h14-16,19H,5-11H2,1-4H3 |
| InChIKey | YNILFPXABRAMMU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|