C16H28N4OS — CID 129345354
(6R)-N-[(3S,5R)-5-tert-butylthiolan-3-yl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 129345354) has the molecular formula C16H28N4OS and a molecular weight of 324.49 g/mol. Its IUPAC name is (6R)-N-[(3S,5R)-5-tert-butylthiolan-3-yl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[(3S,5R)-5-tert-butylthiolan-3-yl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 129345354 |
| Molecular Formula | C16H28N4OS |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (6R)-N-[(3S,5R)-5-tert-butylthiolan-3-yl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | COCc1nc2n(n1)C[C@H](N[C@@H]1CS[C@@H](C(C)(C)C)C1)CC2 |
| InChI | InChI=1S/C16H28N4OS/c1-16(2,3)13-7-12(10-22-13)17-11-5-6-15-18-14(9-21-4)19-20(15)8-11/h11-13,17H,5-10H2,1-4H3/t11-,12+,13-/m1/s1 |
| InChIKey | KAJUVHOSFRTCBP-FRRDWIJNSA-N |
| XLogP | 2.25 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |