C14H20N6O2 — CID 154794226
N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-2-(3-methylimidazol-4-yl)acetamide (PubChem CID 154794226) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-2-(3-methylimidazol-4-yl)acetamide.
| Compound Name | N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-2-(3-methylimidazol-4-yl)acetamide |
|---|---|
| PubChem CID | 154794226 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-2-(3-methylimidazol-4-yl)acetamide |
| SMILES | COCc1nc2n(n1)CC(NC(=O)Cc1cncn1C)CC2 |
| InChI | InChI=1S/C14H20N6O2/c1-19-9-15-6-11(19)5-14(21)16-10-3-4-13-17-12(8-22-2)18-20(13)7-10/h6,9-10H,3-5,7-8H2,1-2H3,(H,16,21) |
| InChIKey | PZOPOEQOMJYPPN-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |