C19H23N5O3 — CID 167743148
N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-4-[methyl(prop-2-enoyl)amino]benzamide (PubChem CID 167743148) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-4-[methyl(prop-2-enoyl)amino]benzamide.
| Compound Name | N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-4-[methyl(prop-2-enoyl)amino]benzamide |
|---|---|
| PubChem CID | 167743148 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-4-[methyl(prop-2-enoyl)amino]benzamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)NC2CCc3nc(COC)nn3C2)cc1 |
| InChI | InChI=1S/C19H23N5O3/c1-4-18(25)23(2)15-8-5-13(6-9-15)19(26)20-14-7-10-17-21-16(12-27-3)22-24(17)11-14/h4-6,8-9,14H,1,7,10-12H2,2-3H3,(H,20,26) |
| InChIKey | IDBIHEHPZMMXFI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|