C16H19NO2 — CID 126831927
1-[(2S,3aS,7aS)-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]prop-2-en-1-one (PubChem CID 126831927) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 1-[(2S,3aS,7aS)-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,3aS,7aS)-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 126831927 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-[(2S,3aS,7aS)-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H]2O[C@H](c3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C16H19NO2/c1-2-16(18)17-10-6-9-14-13(17)11-15(19-14)12-7-4-3-5-8-12/h2-5,7-8,13-15H,1,6,9-11H2/t13-,14-,15-/m0/s1 |
| InChIKey | KUMYYMADWUVGBS-KKUMJFAQSA-N |
| XLogP | 2.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|