C19H24N2O3 — CID 166405884
N-[3-[(2S,3aS,7aS)-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-3-oxopropyl]prop-2-enamide (PubChem CID 166405884) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[3-[(2S,3aS,7aS)-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-3-oxopropyl]prop-2-enamide.
| Compound Name | N-[3-[(2S,3aS,7aS)-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-3-oxopropyl]prop-2-enamide |
|---|---|
| PubChem CID | 166405884 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[3-[(2S,3aS,7aS)-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]-3-oxopropyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC(=O)N1CCC[C@@H]2O[C@H](c3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C19H24N2O3/c1-2-18(22)20-11-10-19(23)21-12-6-9-16-15(21)13-17(24-16)14-7-4-3-5-8-14/h2-5,7-8,15-17H,1,6,9-13H2,(H,20,22)/t15-,16-,17-/m0/s1 |
| InChIKey | JGFIRUVFUWZHIV-ULQDDVLXSA-N |
| XLogP | 2.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|