C16H19ClN2O3 — CID 166405811
N-[3-[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]-3-oxopropyl]prop-2-enamide (PubChem CID 166405811) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is N-[3-[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]-3-oxopropyl]prop-2-enamide.
| Compound Name | N-[3-[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]-3-oxopropyl]prop-2-enamide |
|---|---|
| PubChem CID | 166405811 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[3-[(2R,3R)-2-(4-chlorophenyl)-3-hydroxypyrrolidin-1-yl]-3-oxopropyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC(=O)N1CC[C@@H](O)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-2-14(21)18-9-7-15(22)19-10-8-13(20)16(19)11-3-5-12(17)6-4-11/h2-6,13,16,20H,1,7-10H2,(H,18,21)/t13-,16-/m1/s1 |
| InChIKey | AAPJEKPWVXNXSI-CZUORRHYSA-N |
| XLogP | 1.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|