C16H20N2O4 — CID 167966405
N-[2-[(2R,3R)-3-hydroxy-2-(2-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide (PubChem CID 167966405) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[2-[(2R,3R)-3-hydroxy-2-(2-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-[2-[(2R,3R)-3-hydroxy-2-(2-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 167966405 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[2-[(2R,3R)-3-hydroxy-2-(2-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(=O)N1CC[C@@H](O)[C@H]1c1ccccc1OC |
| InChI | InChI=1S/C16H20N2O4/c1-3-14(20)17-10-15(21)18-9-8-12(19)16(18)11-6-4-5-7-13(11)22-2/h3-7,12,16,19H,1,8-10H2,2H3,(H,17,20)/t12-,16-/m1/s1 |
| InChIKey | RBCZGHSLJNHUFK-MLGOLLRUSA-N |
| XLogP | 0.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|