C14H22N2O2 — CID 126831939
N-[(1R,3R)-3-morpholin-4-ylspiro[3.3]heptan-1-yl]prop-2-enamide (PubChem CID 126831939) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is N-[(1R,3R)-3-morpholin-4-ylspiro[3.3]heptan-1-yl]prop-2-enamide.
| Compound Name | N-[(1R,3R)-3-morpholin-4-ylspiro[3.3]heptan-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 126831939 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N-[(1R,3R)-3-morpholin-4-ylspiro[3.3]heptan-1-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1C[C@@H](N2CCOCC2)C12CCC2 |
| InChI | InChI=1S/C14H22N2O2/c1-2-13(17)15-11-10-12(14(11)4-3-5-14)16-6-8-18-9-7-16/h2,11-12H,1,3-10H2,(H,15,17)/t11-,12-/m1/s1 |
| InChIKey | QKIRDZCMBORCIF-VXGBXAGGSA-N |
| XLogP | 0.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|