C17H19N5O3 — CID 126833774
ethyl 2-[5-[[2-(4-cyanoanilino)acetyl]amino]-3-methylpyrazol-1-yl]acetate (PubChem CID 126833774) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is ethyl 2-[5-[[2-(4-cyanoanilino)acetyl]amino]-3-methylpyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[5-[[2-(4-cyanoanilino)acetyl]amino]-3-methylpyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 126833774 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | ethyl 2-[5-[[2-(4-cyanoanilino)acetyl]amino]-3-methylpyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(C)cc1NC(=O)CNc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H19N5O3/c1-3-25-17(24)11-22-15(8-12(2)21-22)20-16(23)10-19-14-6-4-13(9-18)5-7-14/h4-8,19H,3,10-11H2,1-2H3,(H,20,23) |
| InChIKey | LEQQTSQEXMDYHQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |