C14H18N2O4S2 — CID 126833927
N-(1,2-benzothiazol-3-yl)-2-methoxy-2-(oxolan-3-yl)ethanesulfonamide (PubChem CID 126833927) has the molecular formula C14H18N2O4S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(1,2-benzothiazol-3-yl)-2-methoxy-2-(oxolan-3-yl)ethanesulfonamide.
| Compound Name | N-(1,2-benzothiazol-3-yl)-2-methoxy-2-(oxolan-3-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 126833927 |
| Molecular Formula | C14H18N2O4S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-(1,2-benzothiazol-3-yl)-2-methoxy-2-(oxolan-3-yl)ethanesulfonamide |
| SMILES | COC(CS(=O)(=O)Nc1nsc2ccccc12)C1CCOC1 |
| InChI | InChI=1S/C14H18N2O4S2/c1-19-12(10-6-7-20-8-10)9-22(17,18)16-14-11-4-2-3-5-13(11)21-15-14/h2-5,10,12H,6-9H2,1H3,(H,15,16) |
| InChIKey | DEVCWMJUQJGENX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |