C15H17N3O4 — CID 126834092
1-(2-methyltriazol-4-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 126834092) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 1-(2-methyltriazol-4-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(2-methyltriazol-4-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 126834092 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-(2-methyltriazol-4-yl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2cnn(C)n2)c(OC)c1OC |
| InChI | InChI=1S/C15H17N3O4/c1-18-16-9-11(17-18)12(19)7-5-10-6-8-13(20-2)15(22-4)14(10)21-3/h5-9H,1-4H3 |
| InChIKey | OSNVDBRYVQDVIJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|