C16H18N4O2 — CID 126834094
6-[[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]methylidene]-5H-pyrrolo[1,2-a]imidazol-7-one (PubChem CID 126834094) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 6-[[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]methylidene]-5H-pyrrolo[1,2-a]imidazol-7-one.
| Compound Name | 6-[[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]methylidene]-5H-pyrrolo[1,2-a]imidazol-7-one |
|---|---|
| PubChem CID | 126834094 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 6-[[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]methylidene]-5H-pyrrolo[1,2-a]imidazol-7-one |
| SMILES | COCCN(C)c1ccc(C=C2Cn3ccnc3C2=O)cn1 |
| InChI | InChI=1S/C16H18N4O2/c1-19(7-8-22-2)14-4-3-12(10-18-14)9-13-11-20-6-5-17-16(20)15(13)21/h3-6,9-10H,7-8,11H2,1-2H3 |
| InChIKey | CXNVHHOUFJWAFR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|