C19H22N2O4 — CID 167753068
(E)-1-(3,4-dihydroxy-5-methylphenyl)-3-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]prop-2-en-1-one (PubChem CID 167753068) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (E)-1-(3,4-dihydroxy-5-methylphenyl)-3-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dihydroxy-5-methylphenyl)-3-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167753068 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (E)-1-(3,4-dihydroxy-5-methylphenyl)-3-[6-[2-methoxyethyl(methyl)amino]-3-pyridinyl]prop-2-en-1-one |
| SMILES | COCCN(C)c1ccc(/C=C/C(=O)c2cc(C)c(O)c(O)c2)cn1 |
| InChI | InChI=1S/C19H22N2O4/c1-13-10-15(11-17(23)19(13)24)16(22)6-4-14-5-7-18(20-12-14)21(2)8-9-25-3/h4-7,10-12,23-24H,8-9H2,1-3H3/b6-4+ |
| InChIKey | QQOUBEQCQFXYKI-GQCTYLIASA-N |
| XLogP | 2.78 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|