C16H26N4O4 — CID 126834546
ethyl 1-[2-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-2-oxoethyl]piperidine-3-carboxylate (PubChem CID 126834546) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is ethyl 1-[2-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-2-oxoethyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-2-oxoethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 126834546 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | ethyl 1-[2-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-2-oxoethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(CC(=O)Nc2cnn(CCOC)c2)C1 |
| InChI | InChI=1S/C16H26N4O4/c1-3-24-16(22)13-5-4-6-19(10-13)12-15(21)18-14-9-17-20(11-14)7-8-23-2/h9,11,13H,3-8,10,12H2,1-2H3,(H,18,21) |
| InChIKey | NJVJEONITKZFTQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |