C16H23NO3 — CID 126834954
1-[2-(hydroxymethyl)-2,3-dihydroindol-1-yl]-2-pentoxyethanone (PubChem CID 126834954) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-2,3-dihydroindol-1-yl]-2-pentoxyethanone.
| Compound Name | 1-[2-(hydroxymethyl)-2,3-dihydroindol-1-yl]-2-pentoxyethanone |
|---|---|
| PubChem CID | 126834954 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 1-[2-(hydroxymethyl)-2,3-dihydroindol-1-yl]-2-pentoxyethanone |
| SMILES | CCCCCOCC(=O)N1c2ccccc2CC1CO |
| InChI | InChI=1S/C16H23NO3/c1-2-3-6-9-20-12-16(19)17-14(11-18)10-13-7-4-5-8-15(13)17/h4-5,7-8,14,18H,2-3,6,9-12H2,1H3 |
| InChIKey | KBRMNZHNOUULTO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|