C10H12N2 — CID 126838928
3-ethynyl-2-methyl-4,5,6,7-tetrahydroindazole (PubChem CID 126838928) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-ethynyl-2-methyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 3-ethynyl-2-methyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 126838928 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-ethynyl-2-methyl-4,5,6,7-tetrahydroindazole |
| SMILES | C#Cc1c2c(nn1C)CCCC2 |
| InChI | InChI=1S/C10H12N2/c1-3-10-8-6-4-5-7-9(8)11-12(10)2/h1H,4-7H2,2H3 |
| InChIKey | AUKFKYFEJRLIGK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|