C10H18N2 — CID 127012036
4-butyl-1,3,5-trimethylpyrazole (PubChem CID 127012036) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 4-butyl-1,3,5-trimethylpyrazole.
| Compound Name | 4-butyl-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 127012036 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 4-butyl-1,3,5-trimethylpyrazole |
| SMILES | CCCCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C10H18N2/c1-5-6-7-10-8(2)11-12(4)9(10)3/h5-7H2,1-4H3 |
| InChIKey | VATBZRHAWKEGHO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |