About N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide
N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide (PubChem CID 126839710) has the molecular formula C14H15FN4O
and a molecular weight of 274.30 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide.
Molecular Properties
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide |
| PubChem CID | 126839710 |
| Molecular Formula | C14H15FN4O |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)N1CCn2ccnc21 |
| InChI | InChI=1S/C14H15FN4O/c15-12-3-1-11(2-4-12)5-6-17-14(20)19-10-9-18-8-7-16-13(18)19/h1-4,7-8H,5-6,9-10H2,(H,17,20) |
| InChIKey | NBYYEHMNICBFPD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide?
The IUPAC name of N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide (CID 126839710) is N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide.
What is the SMILES notation for N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide?
The canonical SMILES for N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide is O=C(NCCc1ccc(F)cc1)N1CCn2ccnc21.
What is the InChIKey of N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide?
The InChIKey is NBYYEHMNICBFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FN4O/c15-12-3-1-11(2-4-12)5-6-17-14(20)19-10-9-18-8-7-16-13(18)19/h1-4,7-8H,5-6,9-10H2,(H,17,20).
What are the key properties of N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide?
N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide has a molecular weight of 274.30 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-fluorophenyl)ethyl]-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxamide is sourced from PubChem (CID 126839710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).