C14H15FN4O3 — CID 126839909
tert-butyl 3-[(6-fluoropyridine-3-carbonyl)amino]-1H-pyrazole-5-carboxylate (PubChem CID 126839909) has the molecular formula C14H15FN4O3 and a molecular weight of 306.30 g/mol. Its IUPAC name is tert-butyl 3-[(6-fluoropyridine-3-carbonyl)amino]-1H-pyrazole-5-carboxylate.
| Compound Name | tert-butyl 3-[(6-fluoropyridine-3-carbonyl)amino]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 126839909 |
| Molecular Formula | C14H15FN4O3 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | tert-butyl 3-[(6-fluoropyridine-3-carbonyl)amino]-1H-pyrazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(NC(=O)c2ccc(F)nc2)n[nH]1 |
| InChI | InChI=1S/C14H15FN4O3/c1-14(2,3)22-13(21)9-6-11(19-18-9)17-12(20)8-4-5-10(15)16-7-8/h4-7H,1-3H3,(H2,17,18,19,20) |
| InChIKey | NELNCOSJRBWMQY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|