C16H25N7O2 — CID 126841644
ethyl 5-[1-[(1-tert-butyltetrazol-5-yl)methyl]pyrrolidin-3-yl]-1H-pyrazole-4-carboxylate (PubChem CID 126841644) has the molecular formula C16H25N7O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is ethyl 5-[1-[(1-tert-butyltetrazol-5-yl)methyl]pyrrolidin-3-yl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[1-[(1-tert-butyltetrazol-5-yl)methyl]pyrrolidin-3-yl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 126841644 |
| Molecular Formula | C16H25N7O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | ethyl 5-[1-[(1-tert-butyltetrazol-5-yl)methyl]pyrrolidin-3-yl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1C1CCN(Cc2nnnn2C(C)(C)C)C1 |
| InChI | InChI=1S/C16H25N7O2/c1-5-25-15(24)12-8-17-19-14(12)11-6-7-22(9-11)10-13-18-20-21-23(13)16(2,3)4/h8,11H,5-7,9-10H2,1-4H3,(H,17,19) |
| InChIKey | QJXCTUXJPBPGDE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |