C8H12N2O3S — CID 145046879
ethyl 5-(1-hydroxy-1-sulfanylethyl)-1H-pyrazole-4-carboxylate (PubChem CID 145046879) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is ethyl 5-(1-hydroxy-1-sulfanylethyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(1-hydroxy-1-sulfanylethyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 145046879 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | ethyl 5-(1-hydroxy-1-sulfanylethyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1C(C)(O)S |
| InChI | InChI=1S/C8H12N2O3S/c1-3-13-7(11)5-4-9-10-6(5)8(2,12)14/h4,12,14H,3H2,1-2H3,(H,9,10) |
| InChIKey | OTPLMSGARRUBOF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|