C10H14N2O3 — CID 165436337
ethyl 5-(cyclopropylmethoxy)-1H-pyrazole-4-carboxylate (PubChem CID 165436337) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is ethyl 5-(cyclopropylmethoxy)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(cyclopropylmethoxy)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 165436337 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | ethyl 5-(cyclopropylmethoxy)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1OCC1CC1 |
| InChI | InChI=1S/C10H14N2O3/c1-2-14-10(13)8-5-11-12-9(8)15-6-7-3-4-7/h5,7H,2-4,6H2,1H3,(H,11,12) |
| InChIKey | VEJQMUVVTFZEHX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |