C9H11N3O5 — CID 110480106
3-[(4-ethoxycarbonyl-1H-pyrazol-5-yl)amino]-3-oxopropanoic acid (PubChem CID 110480106) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is 3-[(4-ethoxycarbonyl-1H-pyrazol-5-yl)amino]-3-oxopropanoic acid.
| Compound Name | 3-[(4-ethoxycarbonyl-1H-pyrazol-5-yl)amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 110480106 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3-[(4-ethoxycarbonyl-1H-pyrazol-5-yl)amino]-3-oxopropanoic acid |
| SMILES | CCOC(=O)c1cn[nH]c1NC(=O)CC(=O)O |
| InChI | InChI=1S/C9H11N3O5/c1-2-17-9(16)5-4-10-12-8(5)11-6(13)3-7(14)15/h4H,2-3H2,1H3,(H,14,15)(H2,10,11,12,13) |
| InChIKey | KPBCNTOYXIHFGL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|