About ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate
ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate (PubChem CID 110482748) has the molecular formula C10H15N5O4
and a molecular weight of 269.26 g/mol. Its IUPAC name is ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate |
| PubChem CID | 110482748 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1NC(=O)[C@@H](N)CC(N)=O |
| InChI | InChI=1S/C10H15N5O4/c1-2-19-10(18)5-4-13-15-8(5)14-9(17)6(11)3-7(12)16/h4,6H,2-3,11H2,1H3,(H2,12,16)(H2,13,14,15,17)/t6-/m0/s1 |
| InChIKey | NFGKQOIDDMTWMG-LURJTMIESA-N |
| XLogP | -1.27 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate (CID 110482748) is ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate is CCOC(=O)c1cn[nH]c1NC(=O)[C@@H](N)CC(N)=O.
What is the InChIKey of ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate?
The InChIKey is NFGKQOIDDMTWMG-LURJTMIESA-N. The full InChI is InChI=1S/C10H15N5O4/c1-2-19-10(18)5-4-13-15-8(5)14-9(17)6(11)3-7(12)16/h4,6H,2-3,11H2,1H3,(H2,12,16)(H2,13,14,15,17)/t6-/m0/s1.
What are the key properties of ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate?
ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate has a molecular weight of 269.26 g/mol, XLogP of -1.27, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-1H-pyrazole-4-carboxylate is sourced from PubChem (CID 110482748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).